C17H20N5O3S+ — CID 7293495
2-ethyl-5-[(S)-(4-nitrophenyl)-pyrrolidin-1-ium-1-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 7293495) has the molecular formula C17H20N5O3S+ and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-ethyl-5-[(S)-(4-nitrophenyl)-pyrrolidin-1-ium-1-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 2-ethyl-5-[(S)-(4-nitrophenyl)-pyrrolidin-1-ium-1-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 7293495 |
| Molecular Formula | C17H20N5O3S+ |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-ethyl-5-[(S)-(4-nitrophenyl)-pyrrolidin-1-ium-1-ylmethyl]-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | CCc1nc2sc([C@H](c3ccc([N+](=O)[O-])cc3)[NH+]3CCCC3)c(O)n2n1 |
| InChI | InChI=1S/C17H19N5O3S/c1-2-13-18-17-21(19-13)16(23)15(26-17)14(20-9-3-4-10-20)11-5-7-12(8-6-11)22(24)25/h5-8,14,23H,2-4,9-10H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | YLECQBLIXIPPSB-AWEZNQCLSA-O |
| XLogP | 1.74 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|