C15H18N4O5 — CID 72935084
3-[2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 72935084) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 3-[2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72935084 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[2-[4-(furan-3-carbonyl)-1,4-diazepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)CNC1=O)N1CCCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C15H18N4O5/c20-12-8-16-15(23)19(12)9-13(21)17-3-1-4-18(6-5-17)14(22)11-2-7-24-10-11/h2,7,10H,1,3-6,8-9H2,(H,16,23) |
| InChIKey | HPZINCKYUCIJLR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|