About N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide
N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide (PubChem CID 72935164) has the molecular formula C20H31N3O
and a molecular weight of 329.49 g/mol. Its IUPAC name is N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide.
Molecular Properties
| Compound Name | N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide |
| PubChem CID | 72935164 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCN1C[C@H](C2CC2)[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C20H31N3O/c1-21(2)19-15-23(14-18(19)17-9-10-17)12-11-20(24)22(3)13-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | XRUSNXBTKOFQOI-MOPGFXCFSA-N |
| XLogP | 2.31 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide?
The IUPAC name of N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide (CID 72935164) is N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide.
What is the SMILES notation for N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide?
The canonical SMILES for N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide is CN(Cc1ccccc1)C(=O)CCN1C[C@H](C2CC2)[C@@H](N(C)C)C1.
What is the InChIKey of N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide?
The InChIKey is XRUSNXBTKOFQOI-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H31N3O/c1-21(2)19-15-23(14-18(19)17-9-10-17)12-11-20(24)22(3)13-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3/t18-,19+/m1/s1.
What are the key properties of N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide?
N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide has a molecular weight of 329.49 g/mol, XLogP of 2.31, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-[(3S,4R)-3-cyclopropyl-4-(dimethylamino)pyrrolidin-1-yl]-N-methylpropanamide is sourced from PubChem (CID 72935164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).