C15H19F3N6O — CID 72935380
1-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]urea (PubChem CID 72935380) has the molecular formula C15H19F3N6O and a molecular weight of 356.35 g/mol. Its IUPAC name is 1-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 72935380 |
| Molecular Formula | C15H19F3N6O |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[3-(5-cyclopropylpyrazol-1-yl)propyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]urea |
| SMILES | O=C(NCCCn1nccc1C1CC1)Nc1cnn(CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N6O/c16-15(17,18)10-23-9-12(8-21-23)22-14(25)19-5-1-7-24-13(4-6-20-24)11-2-3-11/h4,6,8-9,11H,1-3,5,7,10H2,(H2,19,22,25) |
| InChIKey | BFEQWRFQVWWFLH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|