C20H26N4O2 — CID 72935493
2-(ethylamino)-N-[(1R,2R)-2-phenylmethoxycyclohexyl]pyrimidine-5-carboxamide (PubChem CID 72935493) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-(ethylamino)-N-[(1R,2R)-2-phenylmethoxycyclohexyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(ethylamino)-N-[(1R,2R)-2-phenylmethoxycyclohexyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72935493 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 2-(ethylamino)-N-[(1R,2R)-2-phenylmethoxycyclohexyl]pyrimidine-5-carboxamide |
| SMILES | CCNc1ncc(C(=O)N[C@@H]2CCCC[C@H]2OCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H26N4O2/c1-2-21-20-22-12-16(13-23-20)19(25)24-17-10-6-7-11-18(17)26-14-15-8-4-3-5-9-15/h3-5,8-9,12-13,17-18H,2,6-7,10-11,14H2,1H3,(H,24,25)(H,21,22,23)/t17-,18-/m1/s1 |
| InChIKey | BIDACEQMCQLATG-QZTJIDSGSA-N |
| XLogP | 3.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |