C14H19F4N3O2 — CID 72935564
1-[4-(1-methylimidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone (PubChem CID 72935564) has the molecular formula C14H19F4N3O2 and a molecular weight of 337.32 g/mol. Its IUPAC name is 1-[4-(1-methylimidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone.
| Compound Name | 1-[4-(1-methylimidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 72935564 |
| Molecular Formula | C14H19F4N3O2 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[4-(1-methylimidazol-2-yl)piperidin-1-yl]-2-(2,2,3,3-tetrafluoropropoxy)ethanone |
| SMILES | Cn1ccnc1C1CCN(C(=O)COCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C14H19F4N3O2/c1-20-7-4-19-12(20)10-2-5-21(6-3-10)11(22)8-23-9-14(17,18)13(15)16/h4,7,10,13H,2-3,5-6,8-9H2,1H3 |
| InChIKey | OQAFMKYCERSXPO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|