About methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate
methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate (PubChem CID 72937370) has the molecular formula C13H19N3O3S
and a molecular weight of 297.38 g/mol. Its IUPAC name is methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate |
| PubChem CID | 72937370 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate |
| SMILES | CCCc1nc(C(=O)N2CCN(C(=O)OC)CC2)cs1 |
| InChI | InChI=1S/C13H19N3O3S/c1-3-4-11-14-10(9-20-11)12(17)15-5-7-16(8-6-15)13(18)19-2/h9H,3-8H2,1-2H3 |
| InChIKey | BWEXHLVBWMTFPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate?
The IUPAC name of methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate (CID 72937370) is methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate.
What is the SMILES notation for methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate?
The canonical SMILES for methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate is CCCc1nc(C(=O)N2CCN(C(=O)OC)CC2)cs1.
What is the InChIKey of methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate?
The InChIKey is BWEXHLVBWMTFPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O3S/c1-3-4-11-14-10(9-20-11)12(17)15-5-7-16(8-6-15)13(18)19-2/h9H,3-8H2,1-2H3.
What are the key properties of methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate?
methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate has a molecular weight of 297.38 g/mol, XLogP of 1.62, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-propyl-1,3-thiazole-4-carbonyl)piperazine-1-carboxylate is sourced from PubChem (CID 72937370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).