About 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one
4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one (PubChem CID 72938107) has the molecular formula C13H14FNO4
and a molecular weight of 267.26 g/mol. Its IUPAC name is 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one |
| PubChem CID | 72938107 |
| Molecular Formula | C13H14FNO4 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(F)cc2N1CC1COCCO1 |
| InChI | InChI=1S/C13H14FNO4/c14-9-1-2-12-11(5-9)15(13(16)8-19-12)6-10-7-17-3-4-18-10/h1-2,5,10H,3-4,6-8H2 |
| InChIKey | XFWHAYLUAUANFE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one?
The IUPAC name of 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one (CID 72938107) is 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one.
What is the SMILES notation for 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one?
The canonical SMILES for 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one is O=C1COc2ccc(F)cc2N1CC1COCCO1.
What is the InChIKey of 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one?
The InChIKey is XFWHAYLUAUANFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO4/c14-9-1-2-12-11(5-9)15(13(16)8-19-12)6-10-7-17-3-4-18-10/h1-2,5,10H,3-4,6-8H2.
What are the key properties of 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one?
4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one has a molecular weight of 267.26 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-dioxan-2-ylmethyl)-6-fluoro-1,4-benzoxazin-3-one is sourced from PubChem (CID 72938107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).