C15H24N2O3 — CID 72938562
7-(2-hydroxyethyl)-2-(3-methylbut-2-enoyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 72938562) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-2-(3-methylbut-2-enoyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 7-(2-hydroxyethyl)-2-(3-methylbut-2-enoyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 72938562 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 7-(2-hydroxyethyl)-2-(3-methylbut-2-enoyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | CC(C)=CC(=O)N1CCC2(CCCN(CCO)C2=O)C1 |
| InChI | InChI=1S/C15H24N2O3/c1-12(2)10-13(19)17-7-5-15(11-17)4-3-6-16(8-9-18)14(15)20/h10,18H,3-9,11H2,1-2H3 |
| InChIKey | DLAYFZKHRLOEGO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|