C19H22N6O — CID 72938798
2-(dimethylamino)-2-(2-methylphenyl)-N-[(1-phenyltetrazol-5-yl)methyl]acetamide (PubChem CID 72938798) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(2-methylphenyl)-N-[(1-phenyltetrazol-5-yl)methyl]acetamide.
| Compound Name | 2-(dimethylamino)-2-(2-methylphenyl)-N-[(1-phenyltetrazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 72938798 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 2-(dimethylamino)-2-(2-methylphenyl)-N-[(1-phenyltetrazol-5-yl)methyl]acetamide |
| SMILES | Cc1ccccc1C(C(=O)NCc1nnnn1-c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H22N6O/c1-14-9-7-8-12-16(14)18(24(2)3)19(26)20-13-17-21-22-23-25(17)15-10-5-4-6-11-15/h4-12,18H,13H2,1-3H3,(H,20,26) |
| InChIKey | GAGMYYVAZHNPQN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |