C16H20N4O2S2 — CID 72938951
1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea (PubChem CID 72938951) has the molecular formula C16H20N4O2S2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea.
| Compound Name | 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea |
|---|---|
| PubChem CID | 72938951 |
| Molecular Formula | C16H20N4O2S2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-3-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]urea |
| SMILES | Cc1nnc(SCCCNC(=O)Nc2ccc3c(c2)CC(C)O3)s1 |
| InChI | InChI=1S/C16H20N4O2S2/c1-10-8-12-9-13(4-5-14(12)22-10)18-15(21)17-6-3-7-23-16-20-19-11(2)24-16/h4-5,9-10H,3,6-8H2,1-2H3,(H2,17,18,21) |
| InChIKey | YKNWXXLXPADNGV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|