About 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine
4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine (PubChem CID 72939023) has the molecular formula C18H31N5O
and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine |
| PubChem CID | 72939023 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine |
| SMILES | CCc1cc(N2CCC(NC3CCOCC3)CC2)nc(N(C)C)n1 |
| InChI | InChI=1S/C18H31N5O/c1-4-14-13-17(21-18(20-14)22(2)3)23-9-5-15(6-10-23)19-16-7-11-24-12-8-16/h13,15-16,19H,4-12H2,1-3H3 |
| InChIKey | IEKWPALZJPSTHS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine?
The IUPAC name of 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine (CID 72939023) is 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine?
The canonical SMILES for 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine is CCc1cc(N2CCC(NC3CCOCC3)CC2)nc(N(C)C)n1.
What is the InChIKey of 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine?
The InChIKey is IEKWPALZJPSTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N5O/c1-4-14-13-17(21-18(20-14)22(2)3)23-9-5-15(6-10-23)19-16-7-11-24-12-8-16/h13,15-16,19H,4-12H2,1-3H3.
What are the key properties of 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine?
4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine has a molecular weight of 333.48 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N,N-dimethyl-6-[4-(oxan-4-ylamino)piperidin-1-yl]pyrimidin-2-amine is sourced from PubChem (CID 72939023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).