About 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine
2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine (PubChem CID 72939220) has the molecular formula C16H18N4OS2
and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine.
Molecular Properties
| Compound Name | 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine |
| PubChem CID | 72939220 |
| Molecular Formula | C16H18N4OS2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine |
| SMILES | COCc1ccc(-c2nc(CCSC)nn2-c2ccccn2)s1 |
| InChI | InChI=1S/C16H18N4OS2/c1-21-11-12-6-7-13(23-12)16-18-14(8-10-22-2)19-20(16)15-5-3-4-9-17-15/h3-7,9H,8,10-11H2,1-2H3 |
| InChIKey | WTACZPRZUKKCNK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine?
The IUPAC name of 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine (CID 72939220) is 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine.
What is the SMILES notation for 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine?
The canonical SMILES for 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine is COCc1ccc(-c2nc(CCSC)nn2-c2ccccn2)s1.
What is the InChIKey of 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine?
The InChIKey is WTACZPRZUKKCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS2/c1-21-11-12-6-7-13(23-12)16-18-14(8-10-22-2)19-20(16)15-5-3-4-9-17-15/h3-7,9H,8,10-11H2,1-2H3.
What are the key properties of 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine?
2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine has a molecular weight of 346.48 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[5-(methoxymethyl)thiophen-2-yl]-3-(2-methylsulfanylethyl)-1,2,4-triazol-1-yl]pyridine is sourced from PubChem (CID 72939220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).