C20H24FN3O3 — CID 72940455
2-(3-ethoxy-5-fluorophenyl)-2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]acetic acid (PubChem CID 72940455) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-(3-ethoxy-5-fluorophenyl)-2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-(3-ethoxy-5-fluorophenyl)-2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 72940455 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-(3-ethoxy-5-fluorophenyl)-2-[4-(3-methyl-2-pyridinyl)piperazin-1-yl]acetic acid |
| SMILES | CCOc1cc(F)cc(C(C(=O)O)N2CCN(c3ncccc3C)CC2)c1 |
| InChI | InChI=1S/C20H24FN3O3/c1-3-27-17-12-15(11-16(21)13-17)18(20(25)26)23-7-9-24(10-8-23)19-14(2)5-4-6-22-19/h4-6,11-13,18H,3,7-10H2,1-2H3,(H,25,26) |
| InChIKey | MANPGWREHVFVKO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |