C15H26N4OS — CID 72940468
N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]-1-propan-2-ylpiperidine-3-carboxamide (PubChem CID 72940468) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]-1-propan-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]-1-propan-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 72940468 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]-1-propan-2-ylpiperidine-3-carboxamide |
| SMILES | CSc1ncc(CNC(=O)C2CCCN(C(C)C)C2)n1C |
| InChI | InChI=1S/C15H26N4OS/c1-11(2)19-7-5-6-12(10-19)14(20)16-8-13-9-17-15(21-4)18(13)3/h9,11-12H,5-8,10H2,1-4H3,(H,16,20) |
| InChIKey | PFGHXQNUXJLZJW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |