About 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea
1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea (PubChem CID 72940540) has the molecular formula C16H18ClN5O4
and a molecular weight of 379.80 g/mol. Its IUPAC name is 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea.
Molecular Properties
| Compound Name | 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea |
| PubChem CID | 72940540 |
| Molecular Formula | C16H18ClN5O4 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea |
| SMILES | COCCn1cncc1CNC(=O)Nc1cc(Cl)c2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H18ClN5O4/c1-25-3-2-22-9-18-6-11(22)7-19-16(24)20-10-4-12(17)15-13(5-10)21-14(23)8-26-15/h4-6,9H,2-3,7-8H2,1H3,(H,21,23)(H2,19,20,24) |
| InChIKey | AVTBYFRJPHTUAR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea?
The IUPAC name of 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea (CID 72940540) is 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea.
What is the SMILES notation for 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea?
The canonical SMILES for 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea is COCCn1cncc1CNC(=O)Nc1cc(Cl)c2c(c1)NC(=O)CO2.
What is the InChIKey of 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea?
The InChIKey is AVTBYFRJPHTUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN5O4/c1-25-3-2-22-9-18-6-11(22)7-19-16(24)20-10-4-12(17)15-13(5-10)21-14(23)8-26-15/h4-6,9H,2-3,7-8H2,1H3,(H,21,23)(H2,19,20,24).
What are the key properties of 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea?
1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea has a molecular weight of 379.80 g/mol, XLogP of 1.84, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-chloro-3-oxo-4H-1,4-benzoxazin-6-yl)-3-[[3-(2-methoxyethyl)imidazol-4-yl]methyl]urea is sourced from PubChem (CID 72940540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).