C17H22N4O2S — CID 72940609
(1-methyl-2-morpholin-4-ylbenzimidazol-5-yl)-thiomorpholin-4-ylmethanone (PubChem CID 72940609) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is (1-methyl-2-morpholin-4-ylbenzimidazol-5-yl)-thiomorpholin-4-ylmethanone.
| Compound Name | (1-methyl-2-morpholin-4-ylbenzimidazol-5-yl)-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 72940609 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (1-methyl-2-morpholin-4-ylbenzimidazol-5-yl)-thiomorpholin-4-ylmethanone |
| SMILES | Cn1c(N2CCOCC2)nc2cc(C(=O)N3CCSCC3)ccc21 |
| InChI | InChI=1S/C17H22N4O2S/c1-19-15-3-2-13(16(22)20-6-10-24-11-7-20)12-14(15)18-17(19)21-4-8-23-9-5-21/h2-3,12H,4-11H2,1H3 |
| InChIKey | JVJKXPMRNYYSDX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |