C18H22F4N2O2 — CID 72940740
1-[(4aR,8aR)-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]ethanone (PubChem CID 72940740) has the molecular formula C18H22F4N2O2 and a molecular weight of 374.38 g/mol. Its IUPAC name is 1-[(4aR,8aR)-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]ethanone.
| Compound Name | 1-[(4aR,8aR)-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 72940740 |
| Molecular Formula | C18H22F4N2O2 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[(4aR,8aR)-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-4a-hydroxy-3,4,5,6,8,8a-hexahydro-1H-2,7-naphthyridin-2-yl]ethanone |
| SMILES | CC(=O)N1CC[C@]2(O)CCN(Cc3ccc(C(F)(F)F)c(F)c3)C[C@@H]2C1 |
| InChI | InChI=1S/C18H22F4N2O2/c1-12(25)24-7-5-17(26)4-6-23(10-14(17)11-24)9-13-2-3-15(16(19)8-13)18(20,21)22/h2-3,8,14,26H,4-7,9-11H2,1H3/t14-,17-/m1/s1 |
| InChIKey | KBNYZPHMJVFFCY-RHSMWYFYSA-N |
| XLogP | 2.65 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |