About N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide
N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide (PubChem CID 72940940) has the molecular formula C16H17N3O3S
and a molecular weight of 331.40 g/mol. Its IUPAC name is N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide.
Molecular Properties
| Compound Name | N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide |
| PubChem CID | 72940940 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide |
| SMILES | Cc1ccc(CN(C)C(=O)CN2C(=O)COc3cccnc32)s1 |
| InChI | InChI=1S/C16H17N3O3S/c1-11-5-6-12(23-11)8-18(2)14(20)9-19-15(21)10-22-13-4-3-7-17-16(13)19/h3-7H,8-10H2,1-2H3 |
| InChIKey | VHMGQOIWHKQWJY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide?
The IUPAC name of N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide (CID 72940940) is N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide.
What is the SMILES notation for N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide?
The canonical SMILES for N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide is Cc1ccc(CN(C)C(=O)CN2C(=O)COc3cccnc32)s1.
What is the InChIKey of N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide?
The InChIKey is VHMGQOIWHKQWJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3S/c1-11-5-6-12(23-11)8-18(2)14(20)9-19-15(21)10-22-13-4-3-7-17-16(13)19/h3-7H,8-10H2,1-2H3.
What are the key properties of N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide?
N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide has a molecular weight of 331.40 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(5-methylthiophen-2-yl)methyl]-2-(3-oxopyrido[3,2-b][1,4]oxazin-4-yl)acetamide is sourced from PubChem (CID 72940940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).