About N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide
N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide (PubChem CID 72940970) has the molecular formula C19H28N4O3
and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
| PubChem CID | 72940970 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide |
| SMILES | CCn1nc(C)c(CCNC(=O)c2coc(CN3CCOCC3)c2)c1C |
| InChI | InChI=1S/C19H28N4O3/c1-4-23-15(3)18(14(2)21-23)5-6-20-19(24)16-11-17(26-13-16)12-22-7-9-25-10-8-22/h11,13H,4-10,12H2,1-3H3,(H,20,24) |
| InChIKey | HDYWHHMBQGTAIE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide?
The IUPAC name of N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide (CID 72940970) is N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide.
What is the SMILES notation for N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide?
The canonical SMILES for N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide is CCn1nc(C)c(CCNC(=O)c2coc(CN3CCOCC3)c2)c1C.
What is the InChIKey of N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide?
The InChIKey is HDYWHHMBQGTAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O3/c1-4-23-15(3)18(14(2)21-23)5-6-20-19(24)16-11-17(26-13-16)12-22-7-9-25-10-8-22/h11,13H,4-10,12H2,1-3H3,(H,20,24).
What are the key properties of N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide?
N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide has a molecular weight of 360.46 g/mol, XLogP of 1.92, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]-5-(morpholin-4-ylmethyl)furan-3-carboxamide is sourced from PubChem (CID 72940970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).