About Sodium mannuronate methylsilanol
Sodium mannuronate methylsilanol (PubChem CID 72941532) has the molecular formula C7H11NaO7Si
and a molecular weight of 258.23 g/mol.
Molecular Properties
| Compound Name | Sodium mannuronate methylsilanol |
| PubChem CID | 72941532 |
| Molecular Formula | C7H11NaO7Si |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | — |
| SMILES | C[Si]O[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H12O7Si.Na/c1-15-14-3(2-8)4(9)5(10)6(11)7(12)13;/h2-6,9-11H,1H3,(H,12,13);/q;+1/p-1/t3-,4-,5+,6+;/m1./s1 |
| InChIKey | UJFLKMBZBZDCPD-QAYODLCCSA-M |
| XLogP | -6.93 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Sodium mannuronate methylsilanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium mannuronate methylsilanol?
The IUPAC name of Sodium mannuronate methylsilanol (CID 72941532) is not available.
What is the SMILES notation for Sodium mannuronate methylsilanol?
The canonical SMILES for Sodium mannuronate methylsilanol is C[Si]O[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)C(=O)[O-].[Na+].
What is the InChIKey of Sodium mannuronate methylsilanol?
The InChIKey is UJFLKMBZBZDCPD-QAYODLCCSA-M. The full InChI is InChI=1S/C7H12O7Si.Na/c1-15-14-3(2-8)4(9)5(10)6(11)7(12)13;/h2-6,9-11H,1H3,(H,12,13);/q;+1/p-1/t3-,4-,5+,6+;/m1./s1.
What are the key properties of Sodium mannuronate methylsilanol?
Sodium mannuronate methylsilanol has a molecular weight of 258.23 g/mol, XLogP of -6.93, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium mannuronate methylsilanol is sourced from PubChem (CID 72941532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).