About (3R)-3,7-dimethyloct-7-enal
(3R)-3,7-dimethyloct-7-enal (PubChem CID 72941638) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is (3R)-3,7-dimethyloct-7-enal.
Molecular Properties
| Compound Name | (3R)-3,7-dimethyloct-7-enal |
| PubChem CID | 72941638 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (3R)-3,7-dimethyloct-7-enal |
| SMILES | C=C(C)CCC[C@@H](C)CC=O |
| InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h8,10H,1,4-7H2,2-3H3/t10-/m1/s1 |
| InChIKey | KQZAHMIZMBERJX-SNVBAGLBSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,7-dimethyloct-7-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,7-dimethyloct-7-enal?
The IUPAC name of (3R)-3,7-dimethyloct-7-enal (CID 72941638) is (3R)-3,7-dimethyloct-7-enal.
What is the SMILES notation for (3R)-3,7-dimethyloct-7-enal?
The canonical SMILES for (3R)-3,7-dimethyloct-7-enal is C=C(C)CCC[C@@H](C)CC=O.
What is the InChIKey of (3R)-3,7-dimethyloct-7-enal?
The InChIKey is KQZAHMIZMBERJX-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h8,10H,1,4-7H2,2-3H3/t10-/m1/s1.
What are the key properties of (3R)-3,7-dimethyloct-7-enal?
(3R)-3,7-dimethyloct-7-enal has a molecular weight of 154.25 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,7-dimethyloct-7-enal is sourced from PubChem (CID 72941638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).