C19H22O5 — CID 72941671
[(1R,2R,3'S,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] 3-methylbutanoate (PubChem CID 72941671) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(1R,2R,3'S,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] 3-methylbutanoate.
| Compound Name | [(1R,2R,3'S,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 72941671 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(1R,2R,3'S,4E,5S)-4-hexa-2,4-diynylidenespiro[3,6-dioxabicyclo[3.1.0]hexane-2,6'-oxane]-3'-yl] 3-methylbutanoate |
| SMILES | CC#CC#C/C=C1/O[C@]2(CC[C@H](OC(=O)CC(C)C)CO2)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C19H22O5/c1-4-5-6-7-8-15-17-18(23-17)19(24-15)10-9-14(12-21-19)22-16(20)11-13(2)3/h8,13-14,17-18H,9-12H2,1-3H3/b15-8+/t14-,17+,18+,19+/m0/s1 |
| InChIKey | IZOBIZVXEKNCNN-ZNQIEUMMSA-N |
| XLogP | 2.16 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|