C40H78N2O4 — CID 72941748
2-butyldecyl N-[3-[(2-butyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 72941748) has the molecular formula C40H78N2O4 and a molecular weight of 651.07 g/mol. Its IUPAC name is 2-butyldecyl N-[3-[(2-butyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2-butyldecyl N-[3-[(2-butyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 72941748 |
| Molecular Formula | C40H78N2O4 |
| Molecular Weight | 651.07 g/mol |
| Exact Mass | 650.60 |
| IUPAC Name | 2-butyldecyl N-[3-[(2-butyldecoxycarbonylamino)methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CCCCCCCCC(CCCC)COC(=O)NCC1(C)CC(NC(=O)OCC(CCCC)CCCCCCCC)CC(C)(C)C1 |
| InChI | InChI=1S/C40H78N2O4/c1-8-12-16-18-20-22-26-34(24-14-10-3)30-45-37(43)41-33-40(7)29-36(28-39(5,6)32-40)42-38(44)46-31-35(25-15-11-4)27-23-21-19-17-13-9-2/h34-36H,8-33H2,1-7H3,(H,41,43)(H,42,44) |
| InChIKey | LYJHSFYLDITYPA-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.07 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|