C12H2Br8O — CID 72941821
1,2,3,4,5-pentabromo-6-(2,3,6-tribromophenoxy)benzene (PubChem CID 72941821) has the molecular formula C12H2Br8O and a molecular weight of 801.38 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-(2,3,6-tribromophenoxy)benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-(2,3,6-tribromophenoxy)benzene |
|---|---|
| PubChem CID | 72941821 |
| Molecular Formula | C12H2Br8O |
| Molecular Weight | 801.38 g/mol |
| Exact Mass | 793.36 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-(2,3,6-tribromophenoxy)benzene |
| SMILES | Brc1ccc(Br)c(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)c1Br |
| InChI | InChI=1S/C12H2Br8O/c13-3-1-2-4(14)11(5(3)15)21-12-9(19)7(17)6(16)8(18)10(12)20/h1-2H |
| InChIKey | JWMXGEPFVCRXQR-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.38 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|