About (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial
(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial (PubChem CID 72941846) has the molecular formula C13H18NO8P
and a molecular weight of 347.26 g/mol. Its IUPAC name is (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial.
Molecular Properties
| Compound Name | (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial |
| PubChem CID | 72941846 |
| Molecular Formula | C13H18NO8P |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial |
| SMILES | Cc1ncc(COP(=O)(O)O)c(C=O)c1O.O=CCCCC=O |
| InChI | InChI=1S/C8H10NO6P.C5H8O2/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;6-4-2-1-3-5-7/h2-3,11H,4H2,1H3,(H2,12,13,14);4-5H,1-3H2 |
| InChIKey | SKKYPUWZZNPUMG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial?
The IUPAC name of (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial (CID 72941846) is (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial.
What is the SMILES notation for (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial?
The canonical SMILES for (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial is Cc1ncc(COP(=O)(O)O)c(C=O)c1O.O=CCCCC=O.
What is the InChIKey of (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial?
The InChIKey is SKKYPUWZZNPUMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO6P.C5H8O2/c1-5-8(11)7(3-10)6(2-9-5)4-15-16(12,13)14;6-4-2-1-3-5-7/h2-3,11H,4H2,1H3,(H2,12,13,14);4-5H,1-3H2.
What are the key properties of (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial?
(4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial has a molecular weight of 347.26 g/mol, XLogP of 1.07, 8 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-5-hydroxy-6-methyl-3-pyridinyl)methyl dihydrogen phosphate;pentanedial is sourced from PubChem (CID 72941846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).