C12H7Cl3O — CID 72941852
1,2-dichloro-3-(3-chlorophenoxy)benzene (PubChem CID 72941852) has the molecular formula C12H7Cl3O and a molecular weight of 273.55 g/mol. Its IUPAC name is 1,2-dichloro-3-(3-chlorophenoxy)benzene.
| Compound Name | 1,2-dichloro-3-(3-chlorophenoxy)benzene |
|---|---|
| PubChem CID | 72941852 |
| Molecular Formula | C12H7Cl3O |
| Molecular Weight | 273.55 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 1,2-dichloro-3-(3-chlorophenoxy)benzene |
| SMILES | Clc1cccc(Oc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C12H7Cl3O/c13-8-3-1-4-9(7-8)16-11-6-2-5-10(14)12(11)15/h1-7H |
| InChIKey | WRBFXFUXFGLONT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |