C12H4Cl6O — CID 72941890
1,2,3,5-tetrachloro-4-(2,5-dichlorophenoxy)benzene (PubChem CID 72941890) has the molecular formula C12H4Cl6O and a molecular weight of 376.88 g/mol. Its IUPAC name is 1,2,3,5-tetrachloro-4-(2,5-dichlorophenoxy)benzene.
| Compound Name | 1,2,3,5-tetrachloro-4-(2,5-dichlorophenoxy)benzene |
|---|---|
| PubChem CID | 72941890 |
| Molecular Formula | C12H4Cl6O |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 373.84 |
| IUPAC Name | 1,2,3,5-tetrachloro-4-(2,5-dichlorophenoxy)benzene |
| SMILES | Clc1ccc(Cl)c(Oc2c(Cl)cc(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C12H4Cl6O/c13-5-1-2-6(14)9(3-5)19-12-8(16)4-7(15)10(17)11(12)18/h1-4H |
| InChIKey | GUWQFNUOPQKNMH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|