About 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride
4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride (PubChem CID 72941952) has the molecular formula C18H27ClN2OS
and a molecular weight of 354.95 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride.
Molecular Properties
| Compound Name | 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride |
| PubChem CID | 72941952 |
| Molecular Formula | C18H27ClN2OS |
| Molecular Weight | 354.95 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride |
| SMILES | CC(C)(C)c1cc(-c2csc(CN)n2)cc(C(C)(C)C)c1O.Cl |
| InChI | InChI=1S/C18H26N2OS.ClH/c1-17(2,3)12-7-11(14-10-22-15(9-19)20-14)8-13(16(12)21)18(4,5)6;/h7-8,10,21H,9,19H2,1-6H3;1H |
| InChIKey | WPWBWGUPSJCKKF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.95 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride?
The IUPAC name of 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride (CID 72941952) is 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride.
What is the SMILES notation for 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride?
The canonical SMILES for 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride is CC(C)(C)c1cc(-c2csc(CN)n2)cc(C(C)(C)C)c1O.Cl.
What is the InChIKey of 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride?
The InChIKey is WPWBWGUPSJCKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2OS.ClH/c1-17(2,3)12-7-11(14-10-22-15(9-19)20-14)8-13(16(12)21)18(4,5)6;/h7-8,10,21H,9,19H2,1-6H3;1H.
What are the key properties of 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride?
4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride has a molecular weight of 354.95 g/mol, XLogP of 4.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(aminomethyl)-1,3-thiazol-4-yl]-2,6-ditert-butylphenol;hydrochloride is sourced from PubChem (CID 72941952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).