C21H27NO5 — CID 72941957
3-(1-hydroxy-2,4-dimethyloct-6-enylidene)-5-[hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione (PubChem CID 72941957) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-(1-hydroxy-2,4-dimethyloct-6-enylidene)-5-[hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione.
| Compound Name | 3-(1-hydroxy-2,4-dimethyloct-6-enylidene)-5-[hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 72941957 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-(1-hydroxy-2,4-dimethyloct-6-enylidene)-5-[hydroxy-(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
| SMILES | CC=CCC(C)CC(C)C(O)=C1C(=O)NC(C(O)c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C21H27NO5/c1-4-5-6-12(2)11-13(3)18(24)16-20(26)17(22-21(16)27)19(25)14-7-9-15(23)10-8-14/h4-5,7-10,12-13,17,19,23-25H,6,11H2,1-3H3,(H,22,27) |
| InChIKey | IWIISBMWNKBQQH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|