C13H11F7N2 — CID 72942199
1-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydroimidazole (PubChem CID 72942199) has the molecular formula C13H11F7N2 and a molecular weight of 328.23 g/mol. Its IUPAC name is 1-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydroimidazole.
| Compound Name | 1-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 72942199 |
| Molecular Formula | C13H11F7N2 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydroimidazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1=NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H11F7N2/c14-11(15,12(16,17)13(18,19)20)10-21-6-7-22(10)8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | QTZAKXBSUHSCJY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|