C12H9F7N2 — CID 72942200
2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenyl-4,5-dihydroimidazole (PubChem CID 72942200) has the molecular formula C12H9F7N2 and a molecular weight of 314.20 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenyl-4,5-dihydroimidazole.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 72942200 |
| Molecular Formula | C12H9F7N2 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-1-phenyl-4,5-dihydroimidazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1=NCCN1c1ccccc1 |
| InChI | InChI=1S/C12H9F7N2/c13-10(14,11(15,16)12(17,18)19)9-20-6-7-21(9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | AUVJDWOHCOSIOS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|