C13H10F7NO — CID 72942282
(4S)-4-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydro-1,3-oxazole (PubChem CID 72942282) has the molecular formula C13H10F7NO and a molecular weight of 329.22 g/mol. Its IUPAC name is (4S)-4-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 72942282 |
| Molecular Formula | C13H10F7NO |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (4S)-4-benzyl-2-(1,1,2,2,3,3,3-heptafluoropropyl)-4,5-dihydro-1,3-oxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C1=N[C@@H](Cc2ccccc2)CO1 |
| InChI | InChI=1S/C13H10F7NO/c14-11(15,12(16,17)13(18,19)20)10-21-9(7-22-10)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-/m0/s1 |
| InChIKey | QYFVACRNVSGUMV-VIFPVBQESA-N |
| XLogP | 3.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|