About 5-(3-hydroxypropyl)-2,3-dimethoxyphenol
5-(3-hydroxypropyl)-2,3-dimethoxyphenol (PubChem CID 72942686) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)-2,3-dimethoxyphenol.
Molecular Properties
| Compound Name | 5-(3-hydroxypropyl)-2,3-dimethoxyphenol |
| PubChem CID | 72942686 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(3-hydroxypropyl)-2,3-dimethoxyphenol |
| SMILES | COc1cc(CCCO)cc(O)c1OC |
| InChI | InChI=1S/C11H16O4/c1-14-10-7-8(4-3-5-12)6-9(13)11(10)15-2/h6-7,12-13H,3-5H2,1-2H3 |
| InChIKey | KULKGPSLJYNYLG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-hydroxypropyl)-2,3-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-hydroxypropyl)-2,3-dimethoxyphenol?
The IUPAC name of 5-(3-hydroxypropyl)-2,3-dimethoxyphenol (CID 72942686) is 5-(3-hydroxypropyl)-2,3-dimethoxyphenol.
What is the SMILES notation for 5-(3-hydroxypropyl)-2,3-dimethoxyphenol?
The canonical SMILES for 5-(3-hydroxypropyl)-2,3-dimethoxyphenol is COc1cc(CCCO)cc(O)c1OC.
What is the InChIKey of 5-(3-hydroxypropyl)-2,3-dimethoxyphenol?
The InChIKey is KULKGPSLJYNYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-14-10-7-8(4-3-5-12)6-9(13)11(10)15-2/h6-7,12-13H,3-5H2,1-2H3.
What are the key properties of 5-(3-hydroxypropyl)-2,3-dimethoxyphenol?
5-(3-hydroxypropyl)-2,3-dimethoxyphenol has a molecular weight of 212.24 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-hydroxypropyl)-2,3-dimethoxyphenol is sourced from PubChem (CID 72942686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).