C22H15ClN2O — CID 72943245
(4-chlorophenyl)-(3,4-diphenyl-1H-pyrazol-5-yl)methanone (PubChem CID 72943245) has the molecular formula C22H15ClN2O and a molecular weight of 358.83 g/mol. Its IUPAC name is (4-chlorophenyl)-(3,4-diphenyl-1H-pyrazol-5-yl)methanone.
| Compound Name | (4-chlorophenyl)-(3,4-diphenyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 72943245 |
| Molecular Formula | C22H15ClN2O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (4-chlorophenyl)-(3,4-diphenyl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1[nH]nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H15ClN2O/c23-18-13-11-17(12-14-18)22(26)21-19(15-7-3-1-4-8-15)20(24-25-21)16-9-5-2-6-10-16/h1-14H,(H,24,25) |
| InChIKey | GSNSLPAOFDZLDA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |