C20H23N5OS — CID 72943364
4-benzyl-3-oxo-N-pyridin-3-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 72943364) has the molecular formula C20H23N5OS and a molecular weight of 381.50 g/mol. Its IUPAC name is 4-benzyl-3-oxo-N-pyridin-3-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | 4-benzyl-3-oxo-N-pyridin-3-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 72943364 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-benzyl-3-oxo-N-pyridin-3-yl-1,4,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | O=C1CNC2(CCN(C(=S)Nc3cccnc3)CC2)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H23N5OS/c26-18-14-22-20(25(18)15-16-5-2-1-3-6-16)8-11-24(12-9-20)19(27)23-17-7-4-10-21-13-17/h1-7,10,13,22H,8-9,11-12,14-15H2,(H,23,27) |
| InChIKey | CWDKJAZABOMODR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|