C19H25N3O4S — CID 72943954
(4S,7S)-4-propan-2-yl-7-[(E)-4-sulfanylbut-1-enyl]-6-oxa-3,10,16-triazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-2,5,9-trione (PubChem CID 72943954) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is (4S,7S)-4-propan-2-yl-7-[(E)-4-sulfanylbut-1-enyl]-6-oxa-3,10,16-triazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-2,5,9-trione.
| Compound Name | (4S,7S)-4-propan-2-yl-7-[(E)-4-sulfanylbut-1-enyl]-6-oxa-3,10,16-triazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-2,5,9-trione |
|---|---|
| PubChem CID | 72943954 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (4S,7S)-4-propan-2-yl-7-[(E)-4-sulfanylbut-1-enyl]-6-oxa-3,10,16-triazabicyclo[10.3.1]hexadeca-1(15),12(16),13-triene-2,5,9-trione |
| SMILES | CC(C)[C@@H]1NC(=O)c2cccc(n2)CNC(=O)C[C@@H](/C=C/CCS)OC1=O |
| InChI | InChI=1S/C19H25N3O4S/c1-12(2)17-19(25)26-14(7-3-4-9-27)10-16(23)20-11-13-6-5-8-15(21-13)18(24)22-17/h3,5-8,12,14,17,27H,4,9-11H2,1-2H3,(H,20,23)(H,22,24)/b7-3+/t14-,17+/m1/s1 |
| InChIKey | OODFAJPRAMSGIF-ADYCGDDGSA-N |
| XLogP | 1.64 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|