C31H32F3N7O5S — CID 72943968
N-[(2S)-6-[[amino-(hydroxyamino)methylidene]amino]-1-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-1-oxohexan-2-yl]benzamide (PubChem CID 72943968) has the molecular formula C31H32F3N7O5S and a molecular weight of 671.70 g/mol. Its IUPAC name is N-[(2S)-6-[[amino-(hydroxyamino)methylidene]amino]-1-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-1-oxohexan-2-yl]benzamide.
| Compound Name | N-[(2S)-6-[[amino-(hydroxyamino)methylidene]amino]-1-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-1-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 72943968 |
| Molecular Formula | C31H32F3N7O5S |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 671.21 |
| IUPAC Name | N-[(2S)-6-[[amino-(hydroxyamino)methylidene]amino]-1-[[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylamino]-1-oxohexan-2-yl]benzamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=O)[C@H](CCCC/N=C(\N)NO)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H32F3N7O5S/c1-20-10-12-21(13-11-20)26-19-27(31(32,33)34)38-41(26)23-14-16-24(17-15-23)47(45,46)40-29(43)25(9-5-6-18-36-30(35)39-44)37-28(42)22-7-3-2-4-8-22/h2-4,7-8,10-17,19,25,44H,5-6,9,18H2,1H3,(H,37,42)(H,40,43)(H3,35,36,39)/t25-/m0/s1 |
| InChIKey | VXSCHNCHHRJIEZ-VWLOTQADSA-N |
| XLogP | 3.93 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|