C23H22F2N2O2 — CID 72943976
4-fluoro-N-[[4-(8-fluoroquinolin-4-yl)oxycyclohexyl]methyl]benzamide (PubChem CID 72943976) has the molecular formula C23H22F2N2O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-fluoro-N-[[4-(8-fluoroquinolin-4-yl)oxycyclohexyl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[4-(8-fluoroquinolin-4-yl)oxycyclohexyl]methyl]benzamide |
|---|---|
| PubChem CID | 72943976 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-fluoro-N-[[4-(8-fluoroquinolin-4-yl)oxycyclohexyl]methyl]benzamide |
| SMILES | O=C(NCC1CCC(Oc2ccnc3c(F)cccc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22F2N2O2/c24-17-8-6-16(7-9-17)23(28)27-14-15-4-10-18(11-5-15)29-21-12-13-26-22-19(21)2-1-3-20(22)25/h1-3,6-9,12-13,15,18H,4-5,10-11,14H2,(H,27,28) |
| InChIKey | SMJFZIKHGRDRRK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |