C22H23N3O4 — CID 72944215
6-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]ethyl]-[1,3]dioxolo[4,5-f]isoindole-5,7-dione (PubChem CID 72944215) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 6-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]ethyl]-[1,3]dioxolo[4,5-f]isoindole-5,7-dione.
| Compound Name | 6-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]ethyl]-[1,3]dioxolo[4,5-f]isoindole-5,7-dione |
|---|---|
| PubChem CID | 72944215 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 6-[2-[1-(pyridin-2-ylmethyl)piperidin-4-yl]ethyl]-[1,3]dioxolo[4,5-f]isoindole-5,7-dione |
| SMILES | O=C1c2cc3c(cc2C(=O)N1CCC1CCN(Cc2ccccn2)CC1)OCO3 |
| InChI | InChI=1S/C22H23N3O4/c26-21-17-11-19-20(29-14-28-19)12-18(17)22(27)25(21)10-6-15-4-8-24(9-5-15)13-16-3-1-2-7-23-16/h1-3,7,11-12,15H,4-6,8-10,13-14H2 |
| InChIKey | PRKLNODBWLOXQS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|