C19H14F6N2OS — CID 72944841
2-ethylsulfanyl-N-prop-2-ynyl-4-(trifluoromethyl)-N-[5-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 72944841) has the molecular formula C19H14F6N2OS and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-prop-2-ynyl-4-(trifluoromethyl)-N-[5-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 2-ethylsulfanyl-N-prop-2-ynyl-4-(trifluoromethyl)-N-[5-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 72944841 |
| Molecular Formula | C19H14F6N2OS |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-ethylsulfanyl-N-prop-2-ynyl-4-(trifluoromethyl)-N-[5-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | C#CCN(C(=O)c1ccc(C(F)(F)F)cc1SCC)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H14F6N2OS/c1-3-9-27(16-8-6-13(11-26-16)19(23,24)25)17(28)14-7-5-12(18(20,21)22)10-15(14)29-4-2/h1,5-8,10-11H,4,9H2,2H3 |
| InChIKey | PCCRPRVYWIJBLK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|