C26H30F2N4O4 — CID 72945050
7-(2,6-difluoro-3,5-dimethoxyphenyl)-9,9-dimethyl-2-(2-morpholin-4-ylethyl)-3,6-dihydropyrrolo[2,3-c][2,7]naphthyridin-8-one (PubChem CID 72945050) has the molecular formula C26H30F2N4O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is 7-(2,6-difluoro-3,5-dimethoxyphenyl)-9,9-dimethyl-2-(2-morpholin-4-ylethyl)-3,6-dihydropyrrolo[2,3-c][2,7]naphthyridin-8-one.
| Compound Name | 7-(2,6-difluoro-3,5-dimethoxyphenyl)-9,9-dimethyl-2-(2-morpholin-4-ylethyl)-3,6-dihydropyrrolo[2,3-c][2,7]naphthyridin-8-one |
|---|---|
| PubChem CID | 72945050 |
| Molecular Formula | C26H30F2N4O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 7-(2,6-difluoro-3,5-dimethoxyphenyl)-9,9-dimethyl-2-(2-morpholin-4-ylethyl)-3,6-dihydropyrrolo[2,3-c][2,7]naphthyridin-8-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(CCN5CCOCC5)cc4c3C(C)(C)C2=O)c1F |
| InChI | InChI=1S/C26H30F2N4O4/c1-26(2)20-15(13-29-24-17(20)11-16(30-24)5-6-31-7-9-36-10-8-31)14-32(25(26)33)23-21(27)18(34-3)12-19(35-4)22(23)28/h11-13H,5-10,14H2,1-4H3,(H,29,30) |
| InChIKey | JATFVWGCEMLNBH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |