C45H59N4+3 — CID 72945129
3-[(2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-[3-(trimethylazaniumyl)propyl]benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]propyl-trimethylazanium (PubChem CID 72945129) has the molecular formula C45H59N4+3 and a molecular weight of 656.00 g/mol. Its IUPAC name is 3-[(2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-[3-(trimethylazaniumyl)propyl]benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]propyl-trimethylazanium.
| Compound Name | 3-[(2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-[3-(trimethylazaniumyl)propyl]benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 72945129 |
| Molecular Formula | C45H59N4+3 |
| Molecular Weight | 656.00 g/mol |
| Exact Mass | 655.47 |
| IUPAC Name | 3-[(2E)-2-[(2E,4E)-5-[1,1-dimethyl-3-[3-(trimethylazaniumyl)propyl]benzo[e]indol-3-ium-2-yl]penta-2,4-dienylidene]-1,1-dimethylbenzo[e]indol-3-yl]propyl-trimethylazanium |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/N(CCC[N+](C)(C)C)c3ccc4ccccc4c3C2(C)C)=[N+](CCC[N+](C)(C)C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C45H59N4/c1-44(2)40(46(30-18-32-48(5,6)7)38-28-26-34-20-14-16-22-36(34)42(38)44)24-12-11-13-25-41-45(3,4)43-37-23-17-15-21-35(37)27-29-39(43)47(41)31-19-33-49(8,9)10/h11-17,20-29H,18-19,30-33H2,1-10H3/q+3 |
| InChIKey | DELBIEPSENIPRM-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.00 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|