C23H20F2N6O3 — CID 72945245
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-pyridin-3-ylethyl)-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 72945245) has the molecular formula C23H20F2N6O3 and a molecular weight of 466.45 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-pyridin-3-ylethyl)-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-pyridin-3-ylethyl)-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 72945245 |
| Molecular Formula | C23H20F2N6O3 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(2-pyridin-3-ylethyl)-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]ncc4c3N(CCc3cccnc3)C2=O)c1F |
| InChI | InChI=1S/C23H20F2N6O3/c1-33-16-8-17(34-2)19(25)21(18(16)24)31-12-14-10-27-22-15(11-28-29-22)20(14)30(23(31)32)7-5-13-4-3-6-26-9-13/h3-4,6,8-11H,5,7,12H2,1-2H3,(H,27,28,29) |
| InChIKey | UGUPJWFYJCPEMX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |