C35H43N5O7 — CID 72945291
6-[(3S,6S,9S,12R)-3-benzyl-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]hexanoic acid (PubChem CID 72945291) has the molecular formula C35H43N5O7 and a molecular weight of 645.76 g/mol. Its IUPAC name is 6-[(3S,6S,9S,12R)-3-benzyl-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]hexanoic acid.
| Compound Name | 6-[(3S,6S,9S,12R)-3-benzyl-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]hexanoic acid |
|---|---|
| PubChem CID | 72945291 |
| Molecular Formula | C35H43N5O7 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 6-[(3S,6S,9S,12R)-3-benzyl-6-[(1-methoxyindol-3-yl)methyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.4.0]hexadecan-9-yl]hexanoic acid |
| SMILES | COn1cc(C[C@@H]2NC(=O)[C@H](CCCCCC(=O)O)NC(=O)[C@H]3CCCCN3C(=O)[C@H](Cc3ccccc3)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C35H43N5O7/c1-47-40-22-24(25-14-8-9-16-29(25)40)21-27-33(44)38-28(20-23-12-4-2-5-13-23)35(46)39-19-11-10-17-30(39)34(45)36-26(32(43)37-27)15-6-3-7-18-31(41)42/h2,4-5,8-9,12-14,16,22,26-28,30H,3,6-7,10-11,15,17-21H2,1H3,(H,36,45)(H,37,43)(H,38,44)(H,41,42)/t26-,27-,28-,30+/m0/s1 |
| InChIKey | NTAHFSRRNUUVIN-VNDOHOEKSA-N |
| XLogP | 2.37 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|