About 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol
6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol (PubChem CID 72945348) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol.
Molecular Properties
| Compound Name | 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol |
| PubChem CID | 72945348 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol |
| SMILES | CC(C)=CCC1C(C)=CCc2c(O)ccc(O)c21 |
| InChI | InChI=1S/C16H20O2/c1-10(2)4-6-12-11(3)5-7-13-14(17)8-9-15(18)16(12)13/h4-5,8-9,12,17-18H,6-7H2,1-3H3 |
| InChIKey | DNRTVBBBBIIOHX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol?
The IUPAC name of 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol (CID 72945348) is 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol.
What is the SMILES notation for 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol?
The canonical SMILES for 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol is CC(C)=CCC1C(C)=CCc2c(O)ccc(O)c21.
What is the InChIKey of 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol?
The InChIKey is DNRTVBBBBIIOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O2/c1-10(2)4-6-12-11(3)5-7-13-14(17)8-9-15(18)16(12)13/h4-5,8-9,12,17-18H,6-7H2,1-3H3.
What are the key properties of 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol?
6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol has a molecular weight of 244.33 g/mol, XLogP of 4.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-(3-methylbut-2-enyl)-5,8-dihydronaphthalene-1,4-diol is sourced from PubChem (CID 72945348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).