About CID 72945837
CID 72945837 (PubChem CID 72945837) has the molecular formula C50H36FeP2+2
and a molecular weight of 754.63 g/mol.
Molecular Properties
| Compound Name | CID 72945837 |
| PubChem CID | 72945837 |
| Molecular Formula | C50H36FeP2+2 |
| Molecular Weight | 754.63 g/mol |
| Exact Mass | 754.16 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](P(c2cccc3ccccc23)c2cccc3ccccc23)[CH]1.[CH]1[CH][CH][C](P(c2cccc3ccccc23)c2cccc3ccccc23)[CH]1.[Fe+2] |
| InChI | InChI=1S/2C25H18P.Fe/c2*1-5-15-22-19(9-1)11-7-17-24(22)26(21-13-3-4-14-21)25-18-8-12-20-10-2-6-16-23(20)25;/h2*1-18H;/q;;+2 |
| InChIKey | LNLSYWCDHOGMPD-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 754.63 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 72945837 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72945837?
The IUPAC name of CID 72945837 (CID 72945837) is not available.
What is the SMILES notation for CID 72945837?
The canonical SMILES for CID 72945837 is [CH]1[CH][CH][C](P(c2cccc3ccccc23)c2cccc3ccccc23)[CH]1.[CH]1[CH][CH][C](P(c2cccc3ccccc23)c2cccc3ccccc23)[CH]1.[Fe+2].
What is the InChIKey of CID 72945837?
The InChIKey is LNLSYWCDHOGMPD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C25H18P.Fe/c2*1-5-15-22-19(9-1)11-7-17-24(22)26(21-13-3-4-14-21)25-18-8-12-20-10-2-6-16-23(20)25;/h2*1-18H;/q;;+2.
What are the key properties of CID 72945837?
CID 72945837 has a molecular weight of 754.63 g/mol, XLogP of 11.57, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72945837 is sourced from PubChem (CID 72945837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).