About 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one
4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one (PubChem CID 72945847) has the molecular formula C13H10N2O3
and a molecular weight of 242.23 g/mol. Its IUPAC name is 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one.
Molecular Properties
| Compound Name | 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one |
| PubChem CID | 72945847 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one |
| SMILES | Cc1c2c(cc3cc([N+](=O)[O-])ccc13)NC(=O)C2 |
| InChI | InChI=1S/C13H10N2O3/c1-7-10-3-2-9(15(17)18)4-8(10)5-12-11(7)6-13(16)14-12/h2-5H,6H2,1H3,(H,14,16) |
| InChIKey | QWUSBLXLUIVVCP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one?
The IUPAC name of 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one (CID 72945847) is 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one.
What is the SMILES notation for 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one?
The canonical SMILES for 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one is Cc1c2c(cc3cc([N+](=O)[O-])ccc13)NC(=O)C2.
What is the InChIKey of 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one?
The InChIKey is QWUSBLXLUIVVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3/c1-7-10-3-2-9(15(17)18)4-8(10)5-12-11(7)6-13(16)14-12/h2-5H,6H2,1H3,(H,14,16).
What are the key properties of 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one?
4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one has a molecular weight of 242.23 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7-nitro-1,3-dihydrobenzo[f]indol-2-one is sourced from PubChem (CID 72945847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).