C28H33ClO6 — CID 72945882
[(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-chloro-6-methylbenzoate (PubChem CID 72945882) has the molecular formula C28H33ClO6 and a molecular weight of 501.02 g/mol. Its IUPAC name is [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-chloro-6-methylbenzoate.
| Compound Name | [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-chloro-6-methylbenzoate |
|---|---|
| PubChem CID | 72945882 |
| Molecular Formula | C28H33ClO6 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | [(1R,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-chloro-6-methylbenzoate |
| SMILES | CC1=C[C@@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1c(C)cccc1Cl)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C28H33ClO6/c1-13-7-6-8-19(29)20(13)25(33)35-24-14(2)11-27-15(3)9-18-21(26(18,4)5)17(23(27)32)10-16(12-30)22(31)28(24,27)34/h6-8,10-11,15,17-18,21-22,24,30-31,34H,9,12H2,1-5H3/t15-,17+,18-,21+,22-,24+,27-,28+/m1/s1 |
| InChIKey | OPNQZGLIFZOFCT-UZESCUOOSA-N |
| XLogP | 3.64 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|