C25H25F3N2O5 — CID 72945963
N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-[[(4E)-4-[[4-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydrochromen-7-yl]oxy]acetamide (PubChem CID 72945963) has the molecular formula C25H25F3N2O5 and a molecular weight of 490.48 g/mol. Its IUPAC name is N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-[[(4E)-4-[[4-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydrochromen-7-yl]oxy]acetamide.
| Compound Name | N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-[[(4E)-4-[[4-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydrochromen-7-yl]oxy]acetamide |
|---|---|
| PubChem CID | 72945963 |
| Molecular Formula | C25H25F3N2O5 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-(3,6-dihydro-2H-pyran-4-ylmethyl)-2-[[(4E)-4-[[4-(trifluoromethyl)phenyl]methoxyimino]-2,3-dihydrochromen-7-yl]oxy]acetamide |
| SMILES | O=C(COc1ccc2c(c1)OCC/C2=N\OCc1ccc(C(F)(F)F)cc1)NCC1=CCOCC1 |
| InChI | InChI=1S/C25H25F3N2O5/c26-25(27,28)19-3-1-18(2-4-19)15-35-30-22-9-12-33-23-13-20(5-6-21(22)23)34-16-24(31)29-14-17-7-10-32-11-8-17/h1-7,13H,8-12,14-16H2,(H,29,31)/b30-22+ |
| InChIKey | UOAFURJIBSMPHZ-JBASAIQMSA-N |
| XLogP | 4.25 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|